CAS 203626-57-7 is the registry number for 5,8-Dimethyl-4-hydroxyquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5,8-dimethyl-1H-quinolin-4-one (CAS 203626-57-7) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5,8-dimethyl-1H-quinolin-4-one. InChIKey: JLOYAQFVPXIJKV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5,8-dimethyl-1H-quinolin-4-one |
| InChIKey | JLOYAQFVPXIJKV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=O)C=CNC2=C(C=C1)C |
Computed by PubChem (NCBI)