CAS 203645-57-2 appears in our catalog under these names: Alpha-Endosulfan-d4, >95% (HPLC), Endosulfan-I-1,1,5,5-d4, 97 atom % D, min 98% Chemical Purity, alpha-Endosulfan D4, alpha-Endosulfan D4 100 µg/mL in Acetone. Offered by: TRC, CDN, Dr. Ehrenstorfer. Available pack sizes: 1mg, 2,5mg, 5mg, 0,01g, 0,005g, 10mg, 1ml.
(1S,2R,8S,9R)-1,9,10,11,12,12-hexachloro-3,3,7,7-tetradeuterio-4,6-dioxa-5lambda4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide (CAS 203645-57-2) is a chemical compound with the molecular formula C9H6Cl6O3S and a molecular weight of 410.9 g/mol. IUPAC name: (1S,2R,8S,9R)-1,9,10,11,12,12-hexachloro-3,3,7,7-tetradeuterio-4,6-dioxa-5lambda4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide. InChIKey: RDYMFSUJUZBWLH-WWUWEAHGSA-N.
| Molecular formula | C9H6Cl6O3S |
|---|---|
| Molecular weight | 410.9 g/mol |
| IUPAC name | (1S,2R,8S,9R)-1,9,10,11,12,12-hexachloro-3,3,7,7-tetradeuterio-4,6-dioxa-5lambda4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide |
| InChIKey | RDYMFSUJUZBWLH-WWUWEAHGSA-N |
| SMILES | [2H]C1([C@@H]2[C@@H]([C@@]3(C(=C([C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl)C(OS(=O)O1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)