Products 203662-51-5
CAS 203662-51-5 appears in our catalog under these names: 4–Allyl–1–Boc–4–hydroxypiperidine, 4-Allyl-1-Boc-4-hydroxypiperidine 95%, tert-Butyl 4-allyl-4-hydroxypiperidine-1-carboxylate, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100g, 10g.
Tert-butyl 4-hydroxy-4-prop-1-en-2-ylpiperidine-1-carboxylate (CAS 203662-51-5) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 4-hydroxy-4-prop-1-en-2-ylpiperidine-1-carboxylate. InChIKey: ZVPLTONZSYXWRR-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-4-prop-1-en-2-ylpiperidine-1-carboxylate |
| InChIKey | ZVPLTONZSYXWRR-UHFFFAOYSA-N |
| SMILES | CC(=C)C1(CCN(CC1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)