CAS 20368-79-0 appears in our catalog under these names: Sodium 4-hydroxyphenyl phosphate, 95%, Sodium 4–hydroxyphenyl phosphate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg, 25mg.
Disodium;(4-hydroxyphenyl) phosphate (CAS 20368-79-0) is a chemical compound with the molecular formula C6H5Na2O5P and a molecular weight of 234.05 g/mol. IUPAC name: disodium;(4-hydroxyphenyl) phosphate. InChIKey: JOYKXZZXDRGNST-UHFFFAOYSA-L.
| Molecular formula | C6H5Na2O5P |
|---|---|
| Molecular weight | 234.05 g/mol |
| IUPAC name | disodium;(4-hydroxyphenyl) phosphate |
| InChIKey | JOYKXZZXDRGNST-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1O)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)