CAS 203714-71-0 appears in our catalog under these names: Hoveyda-Grubbs Catalyst 1st Generation, >95% (HPLC), Dichloro(2-isopropoxyphenylmethylene)(tricyclohexylphosphine)ruthenium (II) 98%, HOVEYDA-GRUBBS CATALYST M70 (C601) UMI, HOVEYDA-GRUBBS CATALYST# M70 (C601) UMI, HOVEYDA-GRUBBS CATALYST# M700. Offered by: TRC, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g, 25g, 2G.
Dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphane (CAS 203714-71-0) is a chemical compound with the molecular formula C28H45Cl2OPRu and a molecular weight of 600.6 g/mol. IUPAC name: dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphane. InChIKey: KMKCJXPECJFQPQ-UHFFFAOYSA-L.
| Molecular formula | C28H45Cl2OPRu |
|---|---|
| Molecular weight | 600.6 g/mol |
| IUPAC name | dichloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphane |
| InChIKey | KMKCJXPECJFQPQ-UHFFFAOYSA-L |
| SMILES | CC(C)OC1=CC=CC=C1C=[Ru](Cl)Cl.C1CCC(CC1)P(C2CCCCC2)C3CCCCC3 |
Computed by PubChem (NCBI)