CAS 203722-04-7 is the registry number for 1,4-DITOSYL-1,4-DIAZEPAN-6-ONE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,4-bis-(4-methylphenyl)sulfonyl-1,4-diazepan-6-one (CAS 203722-04-7) is a chemical compound with the molecular formula C19H22N2O5S2 and a molecular weight of 422.5 g/mol. IUPAC name: 1,4-bis-(4-methylphenyl)sulfonyl-1,4-diazepan-6-one. InChIKey: VRKBVBXGJYUQRB-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O5S2 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 1,4-bis-(4-methylphenyl)sulfonyl-1,4-diazepan-6-one |
| InChIKey | VRKBVBXGJYUQRB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC(=O)C2)S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)