CAS 2037724-11-9 appears in our catalog under these names: 2-((Piperazin-1-yl)methyl)-4H-pyrido(1,2-a)pyrimidin-4-one dihydrochloride, 95%, 2-((Piperazin-1-yl)methyl)-4H-pyrido(1,2-a)pyrimidin-4-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(piperazin-1-ylmethyl)pyrido[1,2-a]pyrimidin-4-one;dihydrochloride (CAS 2037724-11-9) is a chemical compound with the molecular formula C13H18Cl2N4O and a molecular weight of 317.21 g/mol. IUPAC name: 2-(piperazin-1-ylmethyl)pyrido[1,2-a]pyrimidin-4-one;dihydrochloride. InChIKey: CXHOSQFOXIYWTB-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N4O |
|---|---|
| Molecular weight | 317.21 g/mol |
| IUPAC name | 2-(piperazin-1-ylmethyl)pyrido[1,2-a]pyrimidin-4-one;dihydrochloride |
| InChIKey | CXHOSQFOXIYWTB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=O)N3C=CC=CC3=N2.Cl.Cl |
Computed by PubChem (NCBI)