Products 20382-69-8
CAS 20382-69-8 appears in our catalog under these names: R-(-)-Norapomorphine Hydrochloride, R-(-)-Norapomorphine Hydrochloride (1.0mg/ml in Methanol). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
(6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-10,11-diol chloride (CAS 20382-69-8) is a chemical compound with the molecular formula C16H16ClNO2 and a molecular weight of 289.75 g/mol. IUPAC name: (6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-10,11-diol chloride. InChIKey: POIHJFVPVYHGMS-UTONKHPSSA-N.
| Molecular formula | C16H16ClNO2 |
|---|---|
| Molecular weight | 289.75 g/mol |
| IUPAC name | (6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-10,11-diol chloride |
| InChIKey | POIHJFVPVYHGMS-UTONKHPSSA-N |
| SMILES | C1C[NH2+][C@@H]2CC3=C(C4=CC=CC1=C24)C(=C(C=C3)O)O.[Cl-] |
Computed by PubChem (NCBI)