CAS 203856-19-3 is the registry number for 3,4-Dihydro-2,2,4,4-tetramethyl-2H-1-benzothiopyran-6-amine. Offered by: TRC. Available pack sizes: 2,5g.
2,2,4,4-tetramethyl-3H-thiochromen-6-amine (CAS 203856-19-3) is a chemical compound with the molecular formula C13H19NS and a molecular weight of 221.36 g/mol. IUPAC name: 2,2,4,4-tetramethyl-3H-thiochromen-6-amine. InChIKey: PFDZUEWOUUBIFZ-UHFFFAOYSA-N.
| Molecular formula | C13H19NS |
|---|---|
| Molecular weight | 221.36 g/mol |
| IUPAC name | 2,2,4,4-tetramethyl-3H-thiochromen-6-amine |
| InChIKey | PFDZUEWOUUBIFZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(SC2=C1C=C(C=C2)N)(C)C)C |
Computed by PubChem (NCBI)