CAS 203861-10-3 is the registry number for 2,2,2-Trifluoro-1-indolinylethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone (CAS 203861-10-3) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 1-(2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone. InChIKey: NPSZSUAIVBOFOY-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 1-(2,3-dihydroindol-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | NPSZSUAIVBOFOY-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)