CAS 203911-27-7 appears in our catalog under these names: 1-(5-Isoquinolinesulfonyl)-1H-hexahydro-1,4-diazepine, Dihydrochloride, Fasudil dihydrochloride, 98+%, Fasudil dihydrochloride, HA–1077 (hydrochloride), Fasudil 2HCl 98+%. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 25mg, 5g, 10mg, 50mg, 100mg, 250mg, 1g, 50 mg.
5-(1,4-diazepan-1-ylsulfonyl)isoquinoline;dihydrochloride (CAS 203911-27-7) is a chemical compound with the molecular formula C14H19Cl2N3O2S and a molecular weight of 364.3 g/mol. IUPAC name: 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline;dihydrochloride. InChIKey: NOXXIYDYFSNHDF-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O2S |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline;dihydrochloride |
| InChIKey | NOXXIYDYFSNHDF-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3.Cl.Cl |
Computed by PubChem (NCBI)