Products 20397-61-9
CAS 20397-61-9 appears in our catalog under these names: (Z)-2-Fluoro-3-phenylacrylic acid, 95+%, (Z)-2-Fluoro-3-phenylacrylic acid, 95+%, 95+%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
(Z)-2-fluoro-3-phenylprop-2-enoic acid (CAS 20397-61-9) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: (Z)-2-fluoro-3-phenylprop-2-enoic acid. InChIKey: QONCEXMULRJPPY-VURMDHGXSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (Z)-2-fluoro-3-phenylprop-2-enoic acid |
| InChIKey | QONCEXMULRJPPY-VURMDHGXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C(=O)O)\F |
Computed by PubChem (NCBI)
Synonyms:
alpha-Fluorocinnamic acid, 2-Fluoro-3-phenyl-2-propenoic acid, .alpha.-Fluorocinnamic acid, 2-Propenoic acid, 2-fluoro-3-phenyl-, Cinnamic acid, alpha-fluoro-, (2Z)-2-Fluoro-3-phenylacrylic acid, 2-Propenoic acid, 2-fluoro-3-phenyl-, (2Z)-, (2Z)-2-Fluoro-3-phenyl-2-propenoic acid, 1-09-00-00237 (Beilstein Handbook Reference), Cinnamic acid, I+--fluoro-