Products 2040055-84-1
CAS 2040055-84-1 is the registry number for PF-4363467. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[(2S)-4-ethylmorpholin-2-yl]-2-methylphenyl]-4-propan-2-ylbenzenesulfonamide (CAS 2040055-84-1) is a chemical compound with the molecular formula C22H30N2O3S and a molecular weight of 402.6 g/mol. IUPAC name: N-[4-[(2S)-4-ethylmorpholin-2-yl]-2-methylphenyl]-4-propan-2-ylbenzenesulfonamide. InChIKey: SVIVAENOUMHBBT-JOCHJYFZSA-N.
| Molecular formula | C22H30N2O3S |
|---|---|
| Molecular weight | 402.6 g/mol |
| IUPAC name | N-[4-[(2S)-4-ethylmorpholin-2-yl]-2-methylphenyl]-4-propan-2-ylbenzenesulfonamide |
| InChIKey | SVIVAENOUMHBBT-JOCHJYFZSA-N |
| SMILES | CCN1CCO[C@H](C1)C2=CC(=C(C=C2)NS(=O)(=O)C3=CC=C(C=C3)C(C)C)C |
Computed by PubChem (NCBI)