CAS 204063-33-2 appears in our catalog under these names: 2-(Benzhydrylamino)-2-oxoethyl 3-aminopropanoate 2,2,2-trifluoroacetate, 95+%, trifluoroacetic acid [(diphenylmethyl)carbamoyl]methyl 3-aminopropanoate, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[2-(benzhydrylamino)-2-oxoethyl] 3-aminopropanoate;2,2,2-trifluoroacetic acid (CAS 204063-33-2) is a chemical compound with the molecular formula C20H21F3N2O5 and a molecular weight of 426.4 g/mol. IUPAC name: [2-(benzhydrylamino)-2-oxoethyl] 3-aminopropanoate;2,2,2-trifluoroacetic acid. InChIKey: WGLHOFTYMRTIRB-UHFFFAOYSA-N.
| Molecular formula | C20H21F3N2O5 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | [2-(benzhydrylamino)-2-oxoethyl] 3-aminopropanoate;2,2,2-trifluoroacetic acid |
| InChIKey | WGLHOFTYMRTIRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)NC(=O)COC(=O)CCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)