Products 2041259-61-2
CAS 2041259-61-2 is the registry number for 1-Bromo-8-chloro-1,2,3,4-tetrahydronaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-8-chloro-1,2,3,4-tetrahydronaphthalene (CAS 2041259-61-2) is a chemical compound with the molecular formula C10H10BrCl and a molecular weight of 245.54 g/mol. IUPAC name: 1-bromo-8-chloro-1,2,3,4-tetrahydronaphthalene. InChIKey: LJDLVHFDLFVPGG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrCl |
|---|---|
| Molecular weight | 245.54 g/mol |
| IUPAC name | 1-bromo-8-chloro-1,2,3,4-tetrahydronaphthalene |
| InChIKey | LJDLVHFDLFVPGG-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=C2Cl)Br |
Computed by PubChem (NCBI)