Products 204130-08-5
CAS 204130-08-5 is the registry number for RWJ-60475. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[2-(4-bromophenoxy)-5-nitrophenyl]-hydroxymethyl]phosphonic acid (CAS 204130-08-5) is a chemical compound with the molecular formula C13H11BrNO7P and a molecular weight of 404.11 g/mol. IUPAC name: [[2-(4-bromophenoxy)-5-nitrophenyl]-hydroxymethyl]phosphonic acid. InChIKey: JJKCSZKQYMYARX-UHFFFAOYSA-N.
| Molecular formula | C13H11BrNO7P |
|---|---|
| Molecular weight | 404.11 g/mol |
| IUPAC name | [[2-(4-bromophenoxy)-5-nitrophenyl]-hydroxymethyl]phosphonic acid |
| InChIKey | JJKCSZKQYMYARX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)[N+](=O)[O-])C(O)P(=O)(O)O)Br |
Computed by PubChem (NCBI)