CAS 204138-23-8 appears in our catalog under these names: Boc-Ile-OH 1/2H2O, 96%, Boc–L–isoleucine hemihydrate, Boc-L-Ile-OH*0.5 H2O, Boc-Ile-OH·1/2H2O 96%, N-Boc-L-isoleucine Hemihydrate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1kg, 500g, 25g, 100g, 5g, 10g.
Bis((2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid);hydrate (CAS 204138-23-8) is a chemical compound with the molecular formula C22H44N2O9 and a molecular weight of 480.6 g/mol. IUPAC name: bis((2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid);hydrate. InChIKey: NYGJSARLXBZKTA-AQHOMMPKSA-N.
| Molecular formula | C22H44N2O9 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | bis((2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid);hydrate |
| InChIKey | NYGJSARLXBZKTA-AQHOMMPKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C.CC[C@H](C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)