CAS 20424-95-7 is the registry number for Copper 2-Fluoroacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(2-fluoroacetate) (CAS 20424-95-7) is a chemical compound with the molecular formula C4H4CuF2O4 and a molecular weight of 217.61 g/mol. IUPAC name: copper bis(2-fluoroacetate). InChIKey: UMDZPTZRSLRIAV-UHFFFAOYSA-L.
| Molecular formula | C4H4CuF2O4 |
|---|---|
| Molecular weight | 217.61 g/mol |
| IUPAC name | copper bis(2-fluoroacetate) |
| InChIKey | UMDZPTZRSLRIAV-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])F.C(C(=O)[O-])F.[Cu+2] |
Computed by PubChem (NCBI)