CAS 204254-94-4 appears in our catalog under these names: Oseltamivir Impurity 34, Oseltamivir Impurity 21, Oseltamivir Impurity 89, (3R,4R,5R)-4-(1-Ethylpropoxy)-3-hydroxy-5-((methylsulfonyl)oxy)-1-cyclohexene-1-carboxylic Acid Ethyl Ester, >95% (HPLC), (3R,4R,5R)-4-(1-Ethylpropoxy)-3-hydroxy-5-((methylsulfonyl)oxy)-1-cyclohexene-1-carboxylic Acid Ethy, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
Ethyl (3R,4R,5R)-3-hydroxy-5-methylsulfonyloxy-4-pentan-3-yloxycyclohexene-1-carboxylate (CAS 204254-94-4) is a chemical compound with the molecular formula C15H26O7S and a molecular weight of 350.4 g/mol. IUPAC name: ethyl (3R,4R,5R)-3-hydroxy-5-methylsulfonyloxy-4-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: CNFGUAGRJCDUDT-MGPQQGTHSA-N.
| Molecular formula | C15H26O7S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | ethyl (3R,4R,5R)-3-hydroxy-5-methylsulfonyloxy-4-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | CNFGUAGRJCDUDT-MGPQQGTHSA-N |
| SMILES | CCC(CC)O[C@H]1[C@@H](CC(=C[C@H]1O)C(=O)OCC)OS(=O)(=O)C |
Computed by PubChem (NCBI)