Products 204255-04-9
CAS 204255-04-9 appears in our catalog under these names: Oseltamivir Impurity 121, Oseltamivir Impurity 60, N-Desacetyl 5-Azido Oseltamivir, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 50mg.
Ethyl (3S,4R,5S)-4-amino-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 204255-04-9) is a chemical compound with the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. IUPAC name: ethyl (3S,4R,5S)-4-amino-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: UXJWNTIKRKKBGZ-RWMBFGLXSA-N.
| Molecular formula | C14H24N4O3 |
|---|---|
| Molecular weight | 296.37 g/mol |
| IUPAC name | ethyl (3S,4R,5S)-4-amino-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | UXJWNTIKRKKBGZ-RWMBFGLXSA-N |
| SMILES | CCC(CC)O[C@H]1C=C(C[C@@H]([C@H]1N)N=[N+]=[N-])C(=O)OCC |
Computed by PubChem (NCBI)