Products 204265-70-3

CAS 204265-70-3 is the registry number for Diethyl 3,3'-(2,7-dibromo-9h-fluorene-9,9-diyl)dipropanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-[2,7-dibromo-9-(3-ethoxy-3-oxopropyl)fluoren-9-yl]propanoate (CAS 204265-70-3) is a chemical compound with the molecular formula C23H24Br2O4 and a molecular weight of 524.2 g/mol. IUPAC name: ethyl 3-[2,7-dibromo-9-(3-ethoxy-3-oxopropyl)fluoren-9-yl]propanoate. InChIKey: ZWRMOCJUDYIGND-UHFFFAOYSA-N.

Identity
Molecular formulaC23H24Br2O4
Molecular weight524.2 g/mol
IUPAC nameethyl 3-[2,7-dibromo-9-(3-ethoxy-3-oxopropyl)fluoren-9-yl]propanoate
InChIKeyZWRMOCJUDYIGND-UHFFFAOYSA-N
SMILESCCOC(=O)CCC1(C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br)CCC(=O)OCC

Computed by PubChem (NCBI)