CAS 2042650-70-2 is the registry number for N-Desacryloyl Ritlecitinib. Offered by: TRC. Available pack sizes: 100mg, 10mg.
N-[(3R,6S)-6-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2042650-70-2) is a chemical compound with the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. IUPAC name: N-[(3R,6S)-6-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: QRZXLCPZJWWANB-DTWKUNHWSA-N.
| Molecular formula | C12H17N5 |
|---|---|
| Molecular weight | 231.30 g/mol |
| IUPAC name | N-[(3R,6S)-6-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | QRZXLCPZJWWANB-DTWKUNHWSA-N |
| SMILES | C[C@H]1CC[C@H](CN1)NC2=NC=NC3=C2C=CN3 |
Computed by PubChem (NCBI)