CAS 204268-03-1 appears in our catalog under these names: HIV–1 integrase inhibitor 7, HIV-1 integrase inhibitor 7. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(2R,3R)-2,3-bis[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]oxy]butanedioic acid (CAS 204268-03-1) is a chemical compound with the molecular formula C30H26O16 and a molecular weight of 642.5 g/mol. IUPAC name: (2R,3R)-2,3-bis[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]oxy]butanedioic acid. InChIKey: RMUUAKSNUFVKKT-PMTCXZIRSA-N.
| Molecular formula | C30H26O16 |
|---|---|
| Molecular weight | 642.5 g/mol |
| IUPAC name | (2R,3R)-2,3-bis[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]oxy]butanedioic acid |
| InChIKey | RMUUAKSNUFVKKT-PMTCXZIRSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)/C=C/C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)/C=C/C2=CC(=C(C=C2)OC(=O)C)OC(=O)C)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)