CAS 204315-81-1 appears in our catalog under these names: 2,2'-Dihydroxy-4,4'-diiodobiphenyl, 95%, 4,4'-Diiodo-2,2'-biphenol, 5,5'-Diiodo-[1,1'-biphenyl]-2,2'-diol 95%, 4,4'-Diiodo[1,1'-biphenyl]-2,2'-diol, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
2-(2-hydroxy-4-iodophenyl)-5-iodophenol (CAS 204315-81-1) is a chemical compound with the molecular formula C12H8I2O2 and a molecular weight of 438.00 g/mol. IUPAC name: 2-(2-hydroxy-4-iodophenyl)-5-iodophenol. InChIKey: QLPSDVPSDROOIG-UHFFFAOYSA-N.
| Molecular formula | C12H8I2O2 |
|---|---|
| Molecular weight | 438.00 g/mol |
| IUPAC name | 2-(2-hydroxy-4-iodophenyl)-5-iodophenol |
| InChIKey | QLPSDVPSDROOIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)O)C2=C(C=C(C=C2)I)O |
Computed by PubChem (NCBI)