CAS 204327-16-2 is the registry number for ((1S,3R,4R)-2-Azabicyclo[2.2.1]heptan-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,3R,4R)-2-azabicyclo[2.2.1]heptan-3-yl]methanol (CAS 204327-16-2) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: [(1S,3R,4R)-2-azabicyclo[2.2.1]heptan-3-yl]methanol. InChIKey: CKGOIZORGVFPFX-VQVTYTSYSA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | [(1S,3R,4R)-2-azabicyclo[2.2.1]heptan-3-yl]methanol |
| InChIKey | CKGOIZORGVFPFX-VQVTYTSYSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H](N2)CO |
Computed by PubChem (NCBI)