Products 20438-98-6
CAS 20438-98-6 is the registry number for Imipiramine N-Oxide HCl. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine oxide;hydrochloride (CAS 20438-98-6) is a chemical compound with the molecular formula C19H25ClN2O and a molecular weight of 332.9 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine oxide;hydrochloride. InChIKey: CAHPIJSNOKEGSK-UHFFFAOYSA-N.
| Molecular formula | C19H25ClN2O |
|---|---|
| Molecular weight | 332.9 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine oxide;hydrochloride |
| InChIKey | CAHPIJSNOKEGSK-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCN1C2=CC=CC=C2CCC3=CC=CC=C31)[O-].Cl |
Computed by PubChem (NCBI)