CAS 2044-85-1 appears in our catalog under these names: 2',7'–Dichlorofluorescein diacetate, 2',7'-Dichlorofluorescein diacetate, >95% (HPLC), 2',7'-Dichlorofluorescein diacetate/ 99.08% (existing batch purity), 2',7'-Dichlorofluorescein diacetate, 2',7'-Dichlorofluorescein Diacetate, >98.0%(HPLC)(qNMR). Offered by: GLPBio, TRC, TargetMol, Biosynth, TCI. Available pack sizes: 1g, 250mg, 50mg, 25mg, 100mg, 200mg, 500mg, 2000mg.
(6'-acetyloxy-2',7'-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (CAS 2044-85-1) is a chemical compound with the molecular formula C24H14Cl2O7 and a molecular weight of 485.3 g/mol. IUPAC name: (6'-acetyloxy-2',7'-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate. InChIKey: VQVUBYASAICPFU-UHFFFAOYSA-N.
| Molecular formula | C24H14Cl2O7 |
|---|---|
| Molecular weight | 485.3 g/mol |
| IUPAC name | (6'-acetyloxy-2',7'-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChIKey | VQVUBYASAICPFU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(=C1)OC3=CC(=C(C=C3C24C5=CC=CC=C5C(=O)O4)Cl)OC(=O)C)Cl |
Computed by PubChem (NCBI)