CAS 2044704-57-4 appears in our catalog under these names: 2-tert-Butylamino-1-(4-hydroxy-3-methylp, 4-(2-(tert-Butylamino)-1-hydroxyethyl)-2-methylphenol hemisulfate, 95%, 95%. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 1EA, 10mg, 25mg.
Bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid (CAS 2044704-57-4) is a chemical compound with the molecular formula C26H44N2O8S and a molecular weight of 544.7 g/mol. IUPAC name: bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid. InChIKey: JJAOBLMGZKBLSL-UHFFFAOYSA-N.
| Molecular formula | C26H44N2O8S |
|---|---|
| Molecular weight | 544.7 g/mol |
| IUPAC name | bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid |
| InChIKey | JJAOBLMGZKBLSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(CNC(C)(C)C)O)O.CC1=C(C=CC(=C1)C(CNC(C)(C)C)O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)