CAS 2044706-54-7 appears in our catalog under these names: 2-(Benzyloxy)-n-(5-fluoro-2-iodophenyl)acetamide, 97%, 2–(Benzyloxy)–N–(5–fluoro–2–iodophenyl)acetamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
N-(5-fluoro-2-iodophenyl)-2-phenylmethoxyacetamide (CAS 2044706-54-7) is a chemical compound with the molecular formula C15H13FINO2 and a molecular weight of 385.17 g/mol. IUPAC name: N-(5-fluoro-2-iodophenyl)-2-phenylmethoxyacetamide. InChIKey: KRDLNCXOTDASHP-UHFFFAOYSA-N.
| Molecular formula | C15H13FINO2 |
|---|---|
| Molecular weight | 385.17 g/mol |
| IUPAC name | N-(5-fluoro-2-iodophenyl)-2-phenylmethoxyacetamide |
| InChIKey | KRDLNCXOTDASHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(=O)NC2=C(C=CC(=C2)F)I |
Computed by PubChem (NCBI)