CAS 2044707-02-8 appears in our catalog under these names: (2-Chloro-4-fluorobenzyl)hydrazine dihydrochloride, 97%, 97%, [(2-chloro-4-fluorophenyl)methyl]hydrazine dihydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(2-chloro-4-fluorophenyl)methylhydrazine;dihydrochloride (CAS 2044707-02-8) is a chemical compound with the molecular formula C7H10Cl3FN2 and a molecular weight of 247.5 g/mol. IUPAC name: (2-chloro-4-fluorophenyl)methylhydrazine;dihydrochloride. InChIKey: SSLRKYMUVWOICP-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl3FN2 |
|---|---|
| Molecular weight | 247.5 g/mol |
| IUPAC name | (2-chloro-4-fluorophenyl)methylhydrazine;dihydrochloride |
| InChIKey | SSLRKYMUVWOICP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)CNN.Cl.Cl |
Computed by PubChem (NCBI)