CAS 2044708-04-3 is the registry number for Topiroxostat Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
N'-amino-4-(hydrazinecarbonyl)pyridine-2-carboximidamide (CAS 2044708-04-3) is a chemical compound with the molecular formula C7H10N6O and a molecular weight of 194.19 g/mol. IUPAC name: N'-amino-4-(hydrazinecarbonyl)pyridine-2-carboximidamide. InChIKey: MOFIONAUPKUZOV-UHFFFAOYSA-N.
| Molecular formula | C7H10N6O |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | N'-amino-4-(hydrazinecarbonyl)pyridine-2-carboximidamide |
| InChIKey | MOFIONAUPKUZOV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)NN)C(=NN)N |
Computed by PubChem (NCBI)