CAS 2044712-60-7 is the registry number for Ethyl 2-{((tert-butoxy)carbonyl)amino}-3-(4-chlorophenyl)-3-hydroxypropanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 3-(4-chlorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 2044712-60-7) is a chemical compound with the molecular formula C16H22ClNO5 and a molecular weight of 343.80 g/mol. IUPAC name: ethyl 3-(4-chlorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: WJQZUSWGRJVCCG-UHFFFAOYSA-N.
| Molecular formula | C16H22ClNO5 |
|---|---|
| Molecular weight | 343.80 g/mol |
| IUPAC name | ethyl 3-(4-chlorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | WJQZUSWGRJVCCG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C1=CC=C(C=C1)Cl)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)