Products 2044712-96-9

CAS 2044712-96-9 appears in our catalog under these names: 2-Amino-4-chloropent-4-enoic acid hydrochloride, 95%, 2-Amino-4-chloropent-4-enoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-4-chloropent-4-enoic acid;hydrochloride (CAS 2044712-96-9) is a chemical compound with the molecular formula C5H9Cl2NO2 and a molecular weight of 186.03 g/mol. IUPAC name: 2-amino-4-chloropent-4-enoic acid;hydrochloride. InChIKey: HDSIMSWEQNFYAF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9Cl2NO2
Molecular weight186.03 g/mol
IUPAC name2-amino-4-chloropent-4-enoic acid;hydrochloride
InChIKeyHDSIMSWEQNFYAF-UHFFFAOYSA-N
SMILESC=C(CC(C(=O)O)N)Cl.Cl

Computed by PubChem (NCBI)