CAS 2044713-71-3 is the registry number for 2-(Dibromo-2H-1,2,3-triazol-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4,5-dibromotriazol-2-yl)acetic acid (CAS 2044713-71-3) is a chemical compound with the molecular formula C4H3Br2N3O2 and a molecular weight of 284.89 g/mol. IUPAC name: 2-(4,5-dibromotriazol-2-yl)acetic acid. InChIKey: JUCRNHYSVBKGAP-UHFFFAOYSA-N.
| Molecular formula | C4H3Br2N3O2 |
|---|---|
| Molecular weight | 284.89 g/mol |
| IUPAC name | 2-(4,5-dibromotriazol-2-yl)acetic acid |
| InChIKey | JUCRNHYSVBKGAP-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)N1N=C(C(=N1)Br)Br |
Computed by PubChem (NCBI)