Products 2044713-71-3

CAS 2044713-71-3 is the registry number for 2-(Dibromo-2H-1,2,3-triazol-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(4,5-dibromotriazol-2-yl)acetic acid (CAS 2044713-71-3) is a chemical compound with the molecular formula C4H3Br2N3O2 and a molecular weight of 284.89 g/mol. IUPAC name: 2-(4,5-dibromotriazol-2-yl)acetic acid. InChIKey: JUCRNHYSVBKGAP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3Br2N3O2
Molecular weight284.89 g/mol
IUPAC name2-(4,5-dibromotriazol-2-yl)acetic acid
InChIKeyJUCRNHYSVBKGAP-UHFFFAOYSA-N
SMILESC(C(=O)O)N1N=C(C(=N1)Br)Br

Computed by PubChem (NCBI)