CAS 2044713-80-4 appears in our catalog under these names: 6-chloro-4-(trifluoromethyl)pyridazine-3-carboxylate lithium, Lithium 6-chloro-4-(trifluoromethyl)pyridazine-3-carboxylate, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g, 100mg, 250mg.
Lithium 6-chloro-4-(trifluoromethyl)pyridazine-3-carboxylate (CAS 2044713-80-4) is a chemical compound with the molecular formula C6HClF3LiN2O2 and a molecular weight of 232.5 g/mol. IUPAC name: lithium 6-chloro-4-(trifluoromethyl)pyridazine-3-carboxylate. InChIKey: VQJQPCSMGOBDPB-UHFFFAOYSA-M.
| Molecular formula | C6HClF3LiN2O2 |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | lithium 6-chloro-4-(trifluoromethyl)pyridazine-3-carboxylate |
| InChIKey | VQJQPCSMGOBDPB-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(C(=NN=C1Cl)C(=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)