CAS 2044744-62-7 appears in our catalog under these names: 3-(4-Bromophenyl)-3-methylazetidine, trifluoroacetic acid, 95%, 3-(4-Bromophenyl)-3-methylazetidine trifluoroacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
3-(4-bromophenyl)-3-methylazetidine;2,2,2-trifluoroacetic acid (CAS 2044744-62-7) is a chemical compound with the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. IUPAC name: 3-(4-bromophenyl)-3-methylazetidine;2,2,2-trifluoroacetic acid. InChIKey: NXTYPLWYOYXVDZ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO2 |
|---|---|
| Molecular weight | 340.14 g/mol |
| IUPAC name | 3-(4-bromophenyl)-3-methylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | NXTYPLWYOYXVDZ-UHFFFAOYSA-N |
| SMILES | CC1(CNC1)C2=CC=C(C=C2)Br.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)