CAS 2044796-74-7 appears in our catalog under these names: {2-azabicyclo(2.1.1)hexan-1-yl}(phenyl)methanol hydrochloride, 95%, {2-Azabicyclo(2.1.1)hexan-1-yl}(phenyl)methanol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-azabicyclo[2.1.1]hexan-1-yl(phenyl)methanol;hydrochloride (CAS 2044796-74-7) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 2-azabicyclo[2.1.1]hexan-1-yl(phenyl)methanol;hydrochloride. InChIKey: GSPCDXRFOGJSCI-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 2-azabicyclo[2.1.1]hexan-1-yl(phenyl)methanol;hydrochloride |
| InChIKey | GSPCDXRFOGJSCI-UHFFFAOYSA-N |
| SMILES | C1C2CC1(NC2)C(C3=CC=CC=C3)O.Cl |
Computed by PubChem (NCBI)