Products 2044838-01-7
CAS 2044838-01-7 is the registry number for 3-(1-(Propan-2-yl)-1H-pyrazol-4-yl)-7-oxa-2-azaspiro(3.5)nonan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1-propan-2-ylpyrazol-4-yl)-7-oxa-2-azaspiro[3.5]nonan-3-one (CAS 2044838-01-7) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: 1-(1-propan-2-ylpyrazol-4-yl)-7-oxa-2-azaspiro[3.5]nonan-3-one. InChIKey: AVMZNOXAKCCQPB-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 1-(1-propan-2-ylpyrazol-4-yl)-7-oxa-2-azaspiro[3.5]nonan-3-one |
| InChIKey | AVMZNOXAKCCQPB-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C=N1)C2C3(CCOCC3)C(=O)N2 |
Computed by PubChem (NCBI)