CAS 2044901-88-2 is the registry number for 3-Amino-N,N-dimethylazetidine-1-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride (CAS 2044901-88-2) is a chemical compound with the molecular formula C5H14ClN3O2S and a molecular weight of 215.70 g/mol. IUPAC name: 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride. InChIKey: XLJDLLFFMFVAJM-UHFFFAOYSA-N.
| Molecular formula | C5H14ClN3O2S |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | 3-amino-N,N-dimethylazetidine-1-sulfonamide;hydrochloride |
| InChIKey | XLJDLLFFMFVAJM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1CC(C1)N.Cl |
Computed by PubChem (NCBI)