CAS 2044927-01-5 appears in our catalog under these names: 3-((tert-Butyldimethylsilyl)oxy)-3-cyclohexylbutanal, 98%, 3-((tert-Butyldimethylsilyl)oxy)-3-cyclohexylbutanal. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutanal (CAS 2044927-01-5) is a chemical compound with the molecular formula C16H32O2Si and a molecular weight of 284.51 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutanal. InChIKey: RESGFMPWEPLFLX-UHFFFAOYSA-N.
| Molecular formula | C16H32O2Si |
|---|---|
| Molecular weight | 284.51 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutanal |
| InChIKey | RESGFMPWEPLFLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC(C)(CC=O)C1CCCCC1 |
Computed by PubChem (NCBI)