CAS 2045-00-3 appears in our catalog under these names: 2-Arsanilic Acid, >95% (HPLC), o-Arsanilic acid, 2-Aminophenylarsonic Acid, >98.0%(T). Offered by: TRC, Biosynth, TCI. Available pack sizes: 10g, 1g, 0,01kg, 0,005kg, 5g, 25g.
(2-aminophenyl)arsonic acid (CAS 2045-00-3) is a chemical compound with the molecular formula C6H8AsNO3 and a molecular weight of 217.05 g/mol. IUPAC name: (2-aminophenyl)arsonic acid. InChIKey: LQCOCUQCZYAYQK-UHFFFAOYSA-N.
| Molecular formula | C6H8AsNO3 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (2-aminophenyl)arsonic acid |
| InChIKey | LQCOCUQCZYAYQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)[As](=O)(O)O |
Computed by PubChem (NCBI)