Products 204512-90-3
CAS 204512-90-3 appears in our catalog under these names: N-[(3R)-Tetrahydro-3-furanyl]adenosine, 97%, 97%, Tecadenoson, 95%, Tecadenoson/ 99.76% (existing batch purity), Tecadenoson (CVT–510), Tecadenoson. Offered by: Chemat, Combi-blocks, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol (CAS 204512-90-3) is a chemical compound with the molecular formula C14H19N5O5 and a molecular weight of 337.33 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol. InChIKey: OESBDSFYJMDRJY-BAYCTPFLSA-N.
| Molecular formula | C14H19N5O5 |
|---|---|
| Molecular weight | 337.33 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[(3R)-oxolan-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
| InChIKey | OESBDSFYJMDRJY-BAYCTPFLSA-N |
| SMILES | C1COC[C@@H]1NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)