CAS 2047075-24-9 is the registry number for Ethyl (E)-4-(2,4-difluorophenyl)-4-oxobut-2-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-(2,4-difluorophenyl)-4-oxobut-2-enoate (CAS 2047075-24-9) is a chemical compound with the molecular formula C12H10F2O3 and a molecular weight of 240.20 g/mol. IUPAC name: ethyl 4-(2,4-difluorophenyl)-4-oxobut-2-enoate. InChIKey: AGIYLWLVBHFUEQ-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O3 |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | ethyl 4-(2,4-difluorophenyl)-4-oxobut-2-enoate |
| InChIKey | AGIYLWLVBHFUEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)