CAS 2048226-46-4 appears in our catalog under these names: GSK199 analog (hydrochloride), GSK199 analog (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10 mg, 25 mg, 5 mg, 1 mg.
[(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone;hydrochloride (CAS 2048226-46-4) is a chemical compound with the molecular formula C25H30ClN5O2 and a molecular weight of 468.0 g/mol. IUPAC name: [(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone;hydrochloride. InChIKey: XPTWJBGBFGNEIM-GMUIIQOCSA-N.
| Molecular formula | C25H30ClN5O2 |
|---|---|
| Molecular weight | 468.0 g/mol |
| IUPAC name | [(3R)-3-aminopiperidin-1-yl]-[2-(1-ethylindol-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone;hydrochloride |
| InChIKey | XPTWJBGBFGNEIM-GMUIIQOCSA-N |
| SMILES | CCN1C2=CC=CC=C2C=C1C3=NC4=C(N3C)C(=CC(=C4)C(=O)N5CCC[C@H](C5)N)OC.Cl |
Computed by PubChem (NCBI)