CAS 2048228-25-5 is the registry number for rel-tert-Butyl ((3R,4S)-4-hydroxypiperidin-3-yl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate (CAS 2048228-25-5) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate. InChIKey: REUNVCLBHFFYFH-SFYZADRCSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-hydroxypiperidin-3-yl]carbamate |
| InChIKey | REUNVCLBHFFYFH-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNCC[C@@H]1O |
Computed by PubChem (NCBI)