CAS 204862-91-9 is the registry number for rac-BINAP mono-Phosphine Oxide. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane (CAS 204862-91-9) is a chemical compound with the molecular formula C44H32OP2 and a molecular weight of 638.7 g/mol. IUPAC name: [1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane. InChIKey: YWXXETUGBNOVBK-UHFFFAOYSA-N.
| Molecular formula | C44H32OP2 |
|---|---|
| Molecular weight | 638.7 g/mol |
| IUPAC name | [1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane |
| InChIKey | YWXXETUGBNOVBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(=O)(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)