Products 204923-11-5

CAS 204923-11-5 is the registry number for B,B′-[1,1′:4′,1′′-Terphenyl]-4,4′′-diylbis[boronic acid], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

[4-[4-(4-boronophenyl)phenyl]phenyl]boronic acid (CAS 204923-11-5) is a chemical compound with the molecular formula C18H16B2O4 and a molecular weight of 317.9 g/mol. IUPAC name: [4-[4-(4-boronophenyl)phenyl]phenyl]boronic acid. InChIKey: WFBSVQIETPESSI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16B2O4
Molecular weight317.9 g/mol
IUPAC name[4-[4-(4-boronophenyl)phenyl]phenyl]boronic acid
InChIKeyWFBSVQIETPESSI-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)B(O)O)(O)O

Computed by PubChem (NCBI)