CAS 204923-11-5 is the registry number for B,B′-[1,1′:4′,1′′-Terphenyl]-4,4′′-diylbis[boronic acid], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[4-[4-(4-boronophenyl)phenyl]phenyl]boronic acid (CAS 204923-11-5) is a chemical compound with the molecular formula C18H16B2O4 and a molecular weight of 317.9 g/mol. IUPAC name: [4-[4-(4-boronophenyl)phenyl]phenyl]boronic acid. InChIKey: WFBSVQIETPESSI-UHFFFAOYSA-N.
| Molecular formula | C18H16B2O4 |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | [4-[4-(4-boronophenyl)phenyl]phenyl]boronic acid |
| InChIKey | WFBSVQIETPESSI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)B(O)O)(O)O |
Computed by PubChem (NCBI)