CAS 2387892-51-3 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-4,4''-diyldiboronic acid, 98%, [1,1':3',1''-Terphenyl]-4,4''-diyldiboronic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
[4-[3-(4-boronophenyl)phenyl]phenyl]boronic acid (CAS 2387892-51-3) is a chemical compound with the molecular formula C18H16B2O4 and a molecular weight of 317.9 g/mol. IUPAC name: [4-[3-(4-boronophenyl)phenyl]phenyl]boronic acid. InChIKey: XIGNRJHPOQYPLZ-UHFFFAOYSA-N.
| Molecular formula | C18H16B2O4 |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | [4-[3-(4-boronophenyl)phenyl]phenyl]boronic acid |
| InChIKey | XIGNRJHPOQYPLZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=C(C=C3)B(O)O)(O)O |
Computed by PubChem (NCBI)