CAS 204981-48-6 appears in our catalog under these names: CP-195543, 98%, CP-195543. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[(3S,4R)-3-benzyl-4-hydroxy-3,4-dihydro-2H-chromen-7-yl]-4-(trifluoromethyl)benzoic acid (CAS 204981-48-6) is a chemical compound with the molecular formula C24H19F3O4 and a molecular weight of 428.4 g/mol. IUPAC name: 2-[(3S,4R)-3-benzyl-4-hydroxy-3,4-dihydro-2H-chromen-7-yl]-4-(trifluoromethyl)benzoic acid. InChIKey: NZQDWKCNBOELAI-KSFYIVLOSA-N.
| Molecular formula | C24H19F3O4 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | 2-[(3S,4R)-3-benzyl-4-hydroxy-3,4-dihydro-2H-chromen-7-yl]-4-(trifluoromethyl)benzoic acid |
| InChIKey | NZQDWKCNBOELAI-KSFYIVLOSA-N |
| SMILES | C1[C@@H]([C@H](C2=C(O1)C=C(C=C2)C3=C(C=CC(=C3)C(F)(F)F)C(=O)O)O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)