Products 205035-03-6
CAS 205035-03-6 is the registry number for Oxymetazoline Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol;hydrochloride (CAS 205035-03-6) is a chemical compound with the molecular formula C16H23ClN2O and a molecular weight of 294.82 g/mol. IUPAC name: 6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol;hydrochloride. InChIKey: UOAYBLRUWGMAIN-UHFFFAOYSA-N.
| Molecular formula | C16H23ClN2O |
|---|---|
| Molecular weight | 294.82 g/mol |
| IUPAC name | 6-tert-butyl-3-(1H-imidazol-2-ylmethyl)-2,4-dimethylphenol;hydrochloride |
| InChIKey | UOAYBLRUWGMAIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1CC2=NC=CN2)C)O)C(C)(C)C.Cl |
Computed by PubChem (NCBI)